C32H30FN3O5 — CID 58043274
methyl 2-[[4-[4-[(3E)-1-(4-fluoro-2-methylphenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]phenyl]benzoyl]amino]acetate (PubChem CID 58043274) has the molecular formula C32H30FN3O5 and a molecular weight of 555.61 g/mol. Its IUPAC name is methyl 2-[[4-[4-[(3E)-1-(4-fluoro-2-methylphenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]phenyl]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[4-[4-[(3E)-1-(4-fluoro-2-methylphenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]phenyl]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 58043274 |
| Molecular Formula | C32H30FN3O5 |
| Molecular Weight | 555.61 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | methyl 2-[[4-[4-[(3E)-1-(4-fluoro-2-methylphenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]phenyl]benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc(-c2ccc(C(C/C(=N\O)c3ccc(=O)n(C)c3)c3ccc(F)cc3C)cc2)cc1 |
| InChI | InChI=1S/C32H30FN3O5/c1-20-16-26(33)13-14-27(20)28(17-29(35-40)25-12-15-30(37)36(2)19-25)23-8-4-21(5-9-23)22-6-10-24(11-7-22)32(39)34-18-31(38)41-3/h4-16,19,28,40H,17-18H2,1-3H3,(H,34,39)/b35-29+ |
| InChIKey | YBTGCDJWCCDJNM-OZMGXUMRSA-N |
| XLogP | 4.80 |
| TPSA | 109.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|