C25H25ClFN3O4 — CID 173006315
4-[1-(2-chlorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]-2-fluoro-N-(2-methoxyethyl)benzamide (PubChem CID 173006315) has the molecular formula C25H25ClFN3O4 and a molecular weight of 485.94 g/mol. Its IUPAC name is 4-[1-(2-chlorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]-2-fluoro-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-[1-(2-chlorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]-2-fluoro-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 173006315 |
| Molecular Formula | C25H25ClFN3O4 |
| Molecular Weight | 485.94 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 4-[1-(2-chlorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]-2-fluoro-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(C(CC(=NO)c2ccc(=O)n(C)c2)c2ccccc2Cl)cc1F |
| InChI | InChI=1S/C25H25ClFN3O4/c1-30-15-17(8-10-24(30)31)23(29-33)14-20(18-5-3-4-6-21(18)26)16-7-9-19(22(27)13-16)25(32)28-11-12-34-2/h3-10,13,15,20,33H,11-12,14H2,1-2H3,(H,28,32) |
| InChIKey | ZPZQQPVZABOIRE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 92.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.94 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|