C28H29ClFN3O3 — CID 90339571
4-[(3E)-1-(2-chlorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]-N-cyclohexyl-2-fluorobenzamide (PubChem CID 90339571) has the molecular formula C28H29ClFN3O3 and a molecular weight of 510.01 g/mol. Its IUPAC name is 4-[(3E)-1-(2-chlorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]-N-cyclohexyl-2-fluorobenzamide.
| Compound Name | 4-[(3E)-1-(2-chlorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]-N-cyclohexyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 90339571 |
| Molecular Formula | C28H29ClFN3O3 |
| Molecular Weight | 510.01 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | 4-[(3E)-1-(2-chlorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]-N-cyclohexyl-2-fluorobenzamide |
| SMILES | Cn1cc(/C(CC(c2ccc(C(=O)NC3CCCCC3)c(F)c2)c2ccccc2Cl)=N/O)ccc1=O |
| InChI | InChI=1S/C28H29ClFN3O3/c1-33-17-19(12-14-27(33)34)26(32-36)16-23(21-9-5-6-10-24(21)29)18-11-13-22(25(30)15-18)28(35)31-20-7-3-2-4-8-20/h5-6,9-15,17,20,23,36H,2-4,7-8,16H2,1H3,(H,31,35)/b32-26+ |
| InChIKey | GVHMCCMGXAHFTN-HMZBKAONSA-N |
| XLogP | 5.64 |
| TPSA | 83.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.01 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|