C29H32ClFN4O3 — CID 76671340
4-[1-(2-chlorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]-2-fluoro-N-methyl-N-(1-methylpiperidin-4-yl)benzamide (PubChem CID 76671340) has the molecular formula C29H32ClFN4O3 and a molecular weight of 539.05 g/mol. Its IUPAC name is 4-[1-(2-chlorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]-2-fluoro-N-methyl-N-(1-methylpiperidin-4-yl)benzamide.
| Compound Name | 4-[1-(2-chlorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]-2-fluoro-N-methyl-N-(1-methylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 76671340 |
| Molecular Formula | C29H32ClFN4O3 |
| Molecular Weight | 539.05 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 4-[1-(2-chlorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]-2-fluoro-N-methyl-N-(1-methylpiperidin-4-yl)benzamide |
| SMILES | CN1CCC(N(C)C(=O)c2ccc(C(CC(=NO)c3ccc(=O)n(C)c3)c3ccccc3Cl)cc2F)CC1 |
| InChI | InChI=1S/C29H32ClFN4O3/c1-33-14-12-21(13-15-33)35(3)29(37)23-10-8-19(16-26(23)31)24(22-6-4-5-7-25(22)30)17-27(32-38)20-9-11-28(36)34(2)18-20/h4-11,16,18,21,24,38H,12-15,17H2,1-3H3 |
| InChIKey | PNSYVBHPLKLNKR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 78.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.05 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|