C20H22BrFN2O2 — CID 86661032
5-[(Z)-C-[2-(4-bromo-2-fluorophenyl)-2-cyclopentylethyl]-N-hydroxycarbonimidoyl]-1-methylpyridin-2-one (PubChem CID 86661032) has the molecular formula C20H22BrFN2O2 and a molecular weight of 421.31 g/mol. Its IUPAC name is 5-[(Z)-C-[2-(4-bromo-2-fluorophenyl)-2-cyclopentylethyl]-N-hydroxycarbonimidoyl]-1-methylpyridin-2-one.
| Compound Name | 5-[(Z)-C-[2-(4-bromo-2-fluorophenyl)-2-cyclopentylethyl]-N-hydroxycarbonimidoyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 86661032 |
| Molecular Formula | C20H22BrFN2O2 |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 5-[(Z)-C-[2-(4-bromo-2-fluorophenyl)-2-cyclopentylethyl]-N-hydroxycarbonimidoyl]-1-methylpyridin-2-one |
| SMILES | Cn1cc(/C(CC(c2ccc(Br)cc2F)C2CCCC2)=N\O)ccc1=O |
| InChI | InChI=1S/C20H22BrFN2O2/c1-24-12-14(6-9-20(24)25)19(23-26)11-17(13-4-2-3-5-13)16-8-7-15(21)10-18(16)22/h6-10,12-13,17,26H,2-5,11H2,1H3/b23-19- |
| InChIKey | LTSCEFXURHVBKW-NMWGTECJSA-N |
| XLogP | 4.83 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|