C23H20BrF2IN2O2 — CID 172940468
5-[(E)-C-[2-(4-bromophenyl)-2-(2,4-difluorophenyl)ethyl]-N-hydroxycarbonimidoyl]-1-[(2R)-2-iodopropyl]pyridin-2-one (PubChem CID 172940468) has the molecular formula C23H20BrF2IN2O2 and a molecular weight of 601.23 g/mol. Its IUPAC name is 5-[(E)-C-[2-(4-bromophenyl)-2-(2,4-difluorophenyl)ethyl]-N-hydroxycarbonimidoyl]-1-[(2R)-2-iodopropyl]pyridin-2-one.
| Compound Name | 5-[(E)-C-[2-(4-bromophenyl)-2-(2,4-difluorophenyl)ethyl]-N-hydroxycarbonimidoyl]-1-[(2R)-2-iodopropyl]pyridin-2-one |
|---|---|
| PubChem CID | 172940468 |
| Molecular Formula | C23H20BrF2IN2O2 |
| Molecular Weight | 601.23 g/mol |
| Exact Mass | 599.97 |
| IUPAC Name | 5-[(E)-C-[2-(4-bromophenyl)-2-(2,4-difluorophenyl)ethyl]-N-hydroxycarbonimidoyl]-1-[(2R)-2-iodopropyl]pyridin-2-one |
| SMILES | C[C@@H](I)Cn1cc(/C(CC(c2ccc(Br)cc2)c2ccc(F)cc2F)=N/O)ccc1=O |
| InChI | InChI=1S/C23H20BrF2IN2O2/c1-14(27)12-29-13-16(4-9-23(29)30)22(28-31)11-20(15-2-5-17(24)6-3-15)19-8-7-18(25)10-21(19)26/h2-10,13-14,20,31H,11-12H2,1H3/b28-22+/t14-,20?/m1/s1 |
| InChIKey | RNXAUZZGFYZQDC-ZNGRJUJPSA-N |
| XLogP | 6.11 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.23 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|