C17H16BrF2NO2 — CID 124560664
(3S)-3-(4-bromophenyl)-3-(2,4-difluorophenyl)-N-methoxy-N-methylpropanamide (PubChem CID 124560664) has the molecular formula C17H16BrF2NO2 and a molecular weight of 384.22 g/mol. Its IUPAC name is (3S)-3-(4-bromophenyl)-3-(2,4-difluorophenyl)-N-methoxy-N-methylpropanamide.
| Compound Name | (3S)-3-(4-bromophenyl)-3-(2,4-difluorophenyl)-N-methoxy-N-methylpropanamide |
|---|---|
| PubChem CID | 124560664 |
| Molecular Formula | C17H16BrF2NO2 |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | (3S)-3-(4-bromophenyl)-3-(2,4-difluorophenyl)-N-methoxy-N-methylpropanamide |
| SMILES | CON(C)C(=O)C[C@@H](c1ccc(Br)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H16BrF2NO2/c1-21(23-2)17(22)10-15(11-3-5-12(18)6-4-11)14-8-7-13(19)9-16(14)20/h3-9,15H,10H2,1-2H3/t15-/m0/s1 |
| InChIKey | PQBDMGOEZVYZDT-HNNXBMFYSA-N |
| XLogP | 4.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|