C18H21BrN2O2 — CID 76671583
5-[C-[2-(4-bromophenyl)pentyl]-N-hydroxycarbonimidoyl]-1-methylpyridin-2-one (PubChem CID 76671583) has the molecular formula C18H21BrN2O2 and a molecular weight of 377.28 g/mol. Its IUPAC name is 5-[C-[2-(4-bromophenyl)pentyl]-N-hydroxycarbonimidoyl]-1-methylpyridin-2-one.
| Compound Name | 5-[C-[2-(4-bromophenyl)pentyl]-N-hydroxycarbonimidoyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 76671583 |
| Molecular Formula | C18H21BrN2O2 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 5-[C-[2-(4-bromophenyl)pentyl]-N-hydroxycarbonimidoyl]-1-methylpyridin-2-one |
| SMILES | CCCC(CC(=NO)c1ccc(=O)n(C)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H21BrN2O2/c1-3-4-14(13-5-8-16(19)9-6-13)11-17(20-23)15-7-10-18(22)21(2)12-15/h5-10,12,14,23H,3-4,11H2,1-2H3 |
| InChIKey | NGEZFKWKVAGSEA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|