C25H25BrN2O2 — CID 58043431
5-[(Z)-C-[2-(4-bromophenyl)-2-(2-methylphenyl)ethyl]-N-hydroxycarbonimidoyl]-1-cyclobutylpyridin-2-one (PubChem CID 58043431) has the molecular formula C25H25BrN2O2 and a molecular weight of 465.39 g/mol. Its IUPAC name is 5-[(Z)-C-[2-(4-bromophenyl)-2-(2-methylphenyl)ethyl]-N-hydroxycarbonimidoyl]-1-cyclobutylpyridin-2-one.
| Compound Name | 5-[(Z)-C-[2-(4-bromophenyl)-2-(2-methylphenyl)ethyl]-N-hydroxycarbonimidoyl]-1-cyclobutylpyridin-2-one |
|---|---|
| PubChem CID | 58043431 |
| Molecular Formula | C25H25BrN2O2 |
| Molecular Weight | 465.39 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 5-[(Z)-C-[2-(4-bromophenyl)-2-(2-methylphenyl)ethyl]-N-hydroxycarbonimidoyl]-1-cyclobutylpyridin-2-one |
| SMILES | Cc1ccccc1C(C/C(=N/O)c1ccc(=O)n(C2CCC2)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C25H25BrN2O2/c1-17-5-2-3-8-22(17)23(18-9-12-20(26)13-10-18)15-24(27-30)19-11-14-25(29)28(16-19)21-6-4-7-21/h2-3,5,8-14,16,21,23,30H,4,6-7,15H2,1H3/b27-24- |
| InChIKey | AKEHXNKNUVYOEJ-PNHLSOANSA-N |
| XLogP | 6.04 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.39 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|