C21H17BrFNO2 — CID 66669163
5-[3-(4-bromophenyl)-3-(2-fluorophenyl)propanoyl]-1-methylpyridin-2-one (PubChem CID 66669163) has the molecular formula C21H17BrFNO2 and a molecular weight of 414.27 g/mol. Its IUPAC name is 5-[3-(4-bromophenyl)-3-(2-fluorophenyl)propanoyl]-1-methylpyridin-2-one.
| Compound Name | 5-[3-(4-bromophenyl)-3-(2-fluorophenyl)propanoyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 66669163 |
| Molecular Formula | C21H17BrFNO2 |
| Molecular Weight | 414.27 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 5-[3-(4-bromophenyl)-3-(2-fluorophenyl)propanoyl]-1-methylpyridin-2-one |
| SMILES | Cn1cc(C(=O)CC(c2ccc(Br)cc2)c2ccccc2F)ccc1=O |
| InChI | InChI=1S/C21H17BrFNO2/c1-24-13-15(8-11-21(24)26)20(25)12-18(14-6-9-16(22)10-7-14)17-4-2-3-5-19(17)23/h2-11,13,18H,12H2,1H3 |
| InChIKey | PDGGPCKALPVJMR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.27 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |