C23H23NO4S — CID 66668194
1-methyl-5-[3-(2-methylphenyl)-3-(4-methylsulfonylphenyl)propanoyl]pyridin-2-one (PubChem CID 66668194) has the molecular formula C23H23NO4S and a molecular weight of 409.51 g/mol. Its IUPAC name is 1-methyl-5-[3-(2-methylphenyl)-3-(4-methylsulfonylphenyl)propanoyl]pyridin-2-one.
| Compound Name | 1-methyl-5-[3-(2-methylphenyl)-3-(4-methylsulfonylphenyl)propanoyl]pyridin-2-one |
|---|---|
| PubChem CID | 66668194 |
| Molecular Formula | C23H23NO4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 1-methyl-5-[3-(2-methylphenyl)-3-(4-methylsulfonylphenyl)propanoyl]pyridin-2-one |
| SMILES | Cc1ccccc1C(CC(=O)c1ccc(=O)n(C)c1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C23H23NO4S/c1-16-6-4-5-7-20(16)21(17-8-11-19(12-9-17)29(3,27)28)14-22(25)18-10-13-23(26)24(2)15-18/h4-13,15,21H,14H2,1-3H3 |
| InChIKey | DHYZHYLWOPQCTN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 73.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |