C26H28ClNO5S — CID 66666839
5-[3-(4-chloro-2-methylphenyl)-3-(4-methylsulfonylphenyl)propanoyl]-1-(2-ethoxyethyl)pyridin-2-one (PubChem CID 66666839) has the molecular formula C26H28ClNO5S and a molecular weight of 502.03 g/mol. Its IUPAC name is 5-[3-(4-chloro-2-methylphenyl)-3-(4-methylsulfonylphenyl)propanoyl]-1-(2-ethoxyethyl)pyridin-2-one.
| Compound Name | 5-[3-(4-chloro-2-methylphenyl)-3-(4-methylsulfonylphenyl)propanoyl]-1-(2-ethoxyethyl)pyridin-2-one |
|---|---|
| PubChem CID | 66666839 |
| Molecular Formula | C26H28ClNO5S |
| Molecular Weight | 502.03 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 5-[3-(4-chloro-2-methylphenyl)-3-(4-methylsulfonylphenyl)propanoyl]-1-(2-ethoxyethyl)pyridin-2-one |
| SMILES | CCOCCn1cc(C(=O)CC(c2ccc(S(C)(=O)=O)cc2)c2ccc(Cl)cc2C)ccc1=O |
| InChI | InChI=1S/C26H28ClNO5S/c1-4-33-14-13-28-17-20(7-12-26(28)30)25(29)16-24(23-11-8-21(27)15-18(23)2)19-5-9-22(10-6-19)34(3,31)32/h5-12,15,17,24H,4,13-14,16H2,1-3H3 |
| InChIKey | YYGTXGYSAMADAT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 82.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.03 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|