C17H18Cl2N2O3 — CID 45487786
N-[(2,4-dichlorophenyl)methyl]-1-(2-ethoxyethyl)-6-oxopyridine-3-carboxamide (PubChem CID 45487786) has the molecular formula C17H18Cl2N2O3 and a molecular weight of 369.25 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-1-(2-ethoxyethyl)-6-oxopyridine-3-carboxamide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-1-(2-ethoxyethyl)-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 45487786 |
| Molecular Formula | C17H18Cl2N2O3 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-1-(2-ethoxyethyl)-6-oxopyridine-3-carboxamide |
| SMILES | CCOCCn1cc(C(=O)NCc2ccc(Cl)cc2Cl)ccc1=O |
| InChI | InChI=1S/C17H18Cl2N2O3/c1-2-24-8-7-21-11-13(4-6-16(21)22)17(23)20-10-12-3-5-14(18)9-15(12)19/h3-6,9,11H,2,7-8,10H2,1H3,(H,20,23) |
| InChIKey | NAWKKCKJNQCCAO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|