C21H18ClIN2O4S — CID 143531099
N-[(2-chloro-4-iodophenyl)methyl]-1-[(4-methylsulfonylphenyl)methyl]-6-oxopyridine-3-carboxamide (PubChem CID 143531099) has the molecular formula C21H18ClIN2O4S and a molecular weight of 556.81 g/mol. Its IUPAC name is N-[(2-chloro-4-iodophenyl)methyl]-1-[(4-methylsulfonylphenyl)methyl]-6-oxopyridine-3-carboxamide.
| Compound Name | N-[(2-chloro-4-iodophenyl)methyl]-1-[(4-methylsulfonylphenyl)methyl]-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 143531099 |
| Molecular Formula | C21H18ClIN2O4S |
| Molecular Weight | 556.81 g/mol |
| Exact Mass | 555.97 |
| IUPAC Name | N-[(2-chloro-4-iodophenyl)methyl]-1-[(4-methylsulfonylphenyl)methyl]-6-oxopyridine-3-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(Cn2cc(C(=O)NCc3ccc(I)cc3Cl)ccc2=O)cc1 |
| InChI | InChI=1S/C21H18ClIN2O4S/c1-30(28,29)18-7-2-14(3-8-18)12-25-13-16(5-9-20(25)26)21(27)24-11-15-4-6-17(23)10-19(15)22/h2-10,13H,11-12H2,1H3,(H,24,27) |
| InChIKey | AIAPQHBRTYSORP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.81 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|