C12H8Cl2INO — CID 79777883
1-[(2,4-dichlorophenyl)methyl]-5-iodopyridin-2-one (PubChem CID 79777883) has the molecular formula C12H8Cl2INO and a molecular weight of 380.01 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-5-iodopyridin-2-one.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-5-iodopyridin-2-one |
|---|---|
| PubChem CID | 79777883 |
| Molecular Formula | C12H8Cl2INO |
| Molecular Weight | 380.01 g/mol |
| Exact Mass | 378.90 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-5-iodopyridin-2-one |
| SMILES | O=c1ccc(I)cn1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H8Cl2INO/c13-9-2-1-8(11(14)5-9)6-16-7-10(15)3-4-12(16)17/h1-5,7H,6H2 |
| InChIKey | QFWAFFUAVDHRJB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.01 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|