C22H19BrFNO2S — CID 154034378
5-[3-(4-bromophenyl)-3-(4-fluoro-2-methyl-3-sulfanylphenyl)propanoyl]-1-methylpyridin-2-one (PubChem CID 154034378) has the molecular formula C22H19BrFNO2S and a molecular weight of 460.37 g/mol. Its IUPAC name is 5-[3-(4-bromophenyl)-3-(4-fluoro-2-methyl-3-sulfanylphenyl)propanoyl]-1-methylpyridin-2-one.
| Compound Name | 5-[3-(4-bromophenyl)-3-(4-fluoro-2-methyl-3-sulfanylphenyl)propanoyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 154034378 |
| Molecular Formula | C22H19BrFNO2S |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | 5-[3-(4-bromophenyl)-3-(4-fluoro-2-methyl-3-sulfanylphenyl)propanoyl]-1-methylpyridin-2-one |
| SMILES | Cc1c(C(CC(=O)c2ccc(=O)n(C)c2)c2ccc(Br)cc2)ccc(F)c1S |
| InChI | InChI=1S/C22H19BrFNO2S/c1-13-17(8-9-19(24)22(13)28)18(14-3-6-16(23)7-4-14)11-20(26)15-5-10-21(27)25(2)12-15/h3-10,12,18,28H,11H2,1-2H3 |
| InChIKey | LLMLCASPWVORRK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 39.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|