C23H20N2O2 — CID 67015760
4-[(1R)-3-(1-methyl-6-oxo-3-pyridinyl)-1-(2-methylphenyl)-3-oxopropyl]benzonitrile (PubChem CID 67015760) has the molecular formula C23H20N2O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 4-[(1R)-3-(1-methyl-6-oxo-3-pyridinyl)-1-(2-methylphenyl)-3-oxopropyl]benzonitrile.
| Compound Name | 4-[(1R)-3-(1-methyl-6-oxo-3-pyridinyl)-1-(2-methylphenyl)-3-oxopropyl]benzonitrile |
|---|---|
| PubChem CID | 67015760 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 4-[(1R)-3-(1-methyl-6-oxo-3-pyridinyl)-1-(2-methylphenyl)-3-oxopropyl]benzonitrile |
| SMILES | Cc1ccccc1[C@H](CC(=O)c1ccc(=O)n(C)c1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C23H20N2O2/c1-16-5-3-4-6-20(16)21(18-9-7-17(14-24)8-10-18)13-22(26)19-11-12-23(27)25(2)15-19/h3-12,15,21H,13H2,1-2H3/t21-/m1/s1 |
| InChIKey | LPQFMKFZKLOSKH-OAQYLSRUSA-N |
| XLogP | 3.97 |
| TPSA | 62.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |