C22H29ClN3O2+ — CID 58043258
5-[(E)-C-[2-(2-chlorophenyl)-2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl]-N-hydroxycarbonimidoyl]-1-methylpyridin-2-one (PubChem CID 58043258) has the molecular formula C22H29ClN3O2+ and a molecular weight of 402.95 g/mol. Its IUPAC name is 5-[(E)-C-[2-(2-chlorophenyl)-2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl]-N-hydroxycarbonimidoyl]-1-methylpyridin-2-one.
| Compound Name | 5-[(E)-C-[2-(2-chlorophenyl)-2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl]-N-hydroxycarbonimidoyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 58043258 |
| Molecular Formula | C22H29ClN3O2+ |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 5-[(E)-C-[2-(2-chlorophenyl)-2-(1,1-dimethylpiperidin-1-ium-4-yl)ethyl]-N-hydroxycarbonimidoyl]-1-methylpyridin-2-one |
| SMILES | Cn1cc(/C(CC(c2ccccc2Cl)C2CC[N+](C)(C)CC2)=N/O)ccc1=O |
| InChI | InChI=1S/C22H28ClN3O2/c1-25-15-17(8-9-22(25)27)21(24-28)14-19(18-6-4-5-7-20(18)23)16-10-12-26(2,3)13-11-16/h4-9,15-16,19H,10-14H2,1-3H3/p+1/b24-21+ |
| InChIKey | AXIGBGGJAAXRJE-DARPEHSRSA-O |
| XLogP | 3.88 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|