C24H23ClFN3O3 — CID 173039160
4-[1-(2-chlorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]-N-ethyl-2-fluorobenzamide (PubChem CID 173039160) has the molecular formula C24H23ClFN3O3 and a molecular weight of 455.92 g/mol. Its IUPAC name is 4-[1-(2-chlorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]-N-ethyl-2-fluorobenzamide.
| Compound Name | 4-[1-(2-chlorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]-N-ethyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 173039160 |
| Molecular Formula | C24H23ClFN3O3 |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 4-[1-(2-chlorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]-N-ethyl-2-fluorobenzamide |
| SMILES | CCNC(=O)c1ccc(C(CC(=NO)c2ccc(=O)n(C)c2)c2ccccc2Cl)cc1F |
| InChI | InChI=1S/C24H23ClFN3O3/c1-3-27-24(31)18-10-8-15(12-21(18)26)19(17-6-4-5-7-20(17)25)13-22(28-32)16-9-11-23(30)29(2)14-16/h4-12,14,19,32H,3,13H2,1-2H3,(H,27,31) |
| InChIKey | KFEOJFJUDFNLNW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 83.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|