C29H24ClFN2O4 — CID 173039126
4-[4-[(1S)-1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]phenyl]-3-methylbenzoic acid (PubChem CID 173039126) has the molecular formula C29H24ClFN2O4 and a molecular weight of 518.97 g/mol. Its IUPAC name is 4-[4-[(1S)-1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]phenyl]-3-methylbenzoic acid.
| Compound Name | 4-[4-[(1S)-1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]phenyl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 173039126 |
| Molecular Formula | C29H24ClFN2O4 |
| Molecular Weight | 518.97 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | 4-[4-[(1S)-1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(1-methyl-6-oxo-3-pyridinyl)propyl]phenyl]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1-c1ccc([C@H](CC(=NO)c2ccc(=O)n(C)c2)c2ccc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C29H24ClFN2O4/c1-17-13-20(29(35)36)7-10-23(17)18-3-5-19(6-4-18)25(24-11-9-22(30)14-26(24)31)15-27(32-37)21-8-12-28(34)33(2)16-21/h3-14,16,25,37H,15H2,1-2H3,(H,35,36)/t25-/m0/s1 |
| InChIKey | UJCXRTABMOCFRY-VWLOTQADSA-N |
| XLogP | 6.25 |
| TPSA | 91.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.97 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|