C28H21Cl2FN2O3 — CID 173039078
2-chloro-4-[4-[(1S)-1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(2-methyl-4-pyridinyl)propyl]phenyl]benzoic acid (PubChem CID 173039078) has the molecular formula C28H21Cl2FN2O3 and a molecular weight of 523.39 g/mol. Its IUPAC name is 2-chloro-4-[4-[(1S)-1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(2-methyl-4-pyridinyl)propyl]phenyl]benzoic acid.
| Compound Name | 2-chloro-4-[4-[(1S)-1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(2-methyl-4-pyridinyl)propyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 173039078 |
| Molecular Formula | C28H21Cl2FN2O3 |
| Molecular Weight | 523.39 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | 2-chloro-4-[4-[(1S)-1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(2-methyl-4-pyridinyl)propyl]phenyl]benzoic acid |
| SMILES | Cc1cc(C(C[C@@H](c2ccc(-c3ccc(C(=O)O)c(Cl)c3)cc2)c2ccc(Cl)cc2F)=NO)ccn1 |
| InChI | InChI=1S/C28H21Cl2FN2O3/c1-16-12-20(10-11-32-16)27(33-36)15-24(22-9-7-21(29)14-26(22)31)18-4-2-17(3-5-18)19-6-8-23(28(34)35)25(30)13-19/h2-14,24,36H,15H2,1H3,(H,34,35)/t24-/m0/s1 |
| InChIKey | ZWWSHKZWWCQLOV-DEOSSOPVSA-N |
| XLogP | 7.60 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.39 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|