C26H20ClFN2O4S — CID 136622774
[5-[4-[(3E)-1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(2-methyl-4-pyridinyl)propyl]phenyl]thiophen-2-yl] hydrogen carbonate (PubChem CID 136622774) has the molecular formula C26H20ClFN2O4S and a molecular weight of 510.97 g/mol. Its IUPAC name is [5-[4-[(3E)-1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(2-methyl-4-pyridinyl)propyl]phenyl]thiophen-2-yl] hydrogen carbonate.
| Compound Name | [5-[4-[(3E)-1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(2-methyl-4-pyridinyl)propyl]phenyl]thiophen-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 136622774 |
| Molecular Formula | C26H20ClFN2O4S |
| Molecular Weight | 510.97 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | [5-[4-[(3E)-1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(2-methyl-4-pyridinyl)propyl]phenyl]thiophen-2-yl] hydrogen carbonate |
| SMILES | Cc1cc(/C(CC(c2ccc(-c3ccc(OC(=O)O)s3)cc2)c2ccc(Cl)cc2F)=N/O)ccn1 |
| InChI | InChI=1S/C26H20ClFN2O4S/c1-15-12-18(10-11-29-15)23(30-33)14-21(20-7-6-19(27)13-22(20)28)16-2-4-17(5-3-16)24-8-9-25(35-24)34-26(31)32/h2-13,21,33H,14H2,1H3,(H,31,32)/b30-23+ |
| InChIKey | VUDKIUAFQJVNEQ-JJKYIXSRSA-N |
| XLogP | 7.37 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.97 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|