C28H24ClFN2O3S — CID 154041474
ethyl 4-[4-[1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(2-methyl-4-pyridinyl)propyl]phenyl]thiophene-2-carboxylate (PubChem CID 154041474) has the molecular formula C28H24ClFN2O3S and a molecular weight of 523.03 g/mol. Its IUPAC name is ethyl 4-[4-[1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(2-methyl-4-pyridinyl)propyl]phenyl]thiophene-2-carboxylate.
| Compound Name | ethyl 4-[4-[1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(2-methyl-4-pyridinyl)propyl]phenyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 154041474 |
| Molecular Formula | C28H24ClFN2O3S |
| Molecular Weight | 523.03 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | ethyl 4-[4-[1-(4-chloro-2-fluorophenyl)-3-hydroxyimino-3-(2-methyl-4-pyridinyl)propyl]phenyl]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(C(CC(=NO)c3ccnc(C)c3)c3ccc(Cl)cc3F)cc2)cs1 |
| InChI | InChI=1S/C28H24ClFN2O3S/c1-3-35-28(33)27-13-21(16-36-27)18-4-6-19(7-5-18)24(23-9-8-22(29)14-25(23)30)15-26(32-34)20-10-11-31-17(2)12-20/h4-14,16,24,34H,3,15H2,1-2H3 |
| InChIKey | OZVUEOVKXYTKSL-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.03 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|