C29H25ClN2O3 — CID 159290468
2-chloro-4-[4-[(3Z)-3-hydroxyimino-1-(2-methylphenyl)-3-(2-methyl-4-pyridinyl)propyl]phenyl]benzoic acid (PubChem CID 159290468) has the molecular formula C29H25ClN2O3 and a molecular weight of 484.98 g/mol. Its IUPAC name is 2-chloro-4-[4-[(3Z)-3-hydroxyimino-1-(2-methylphenyl)-3-(2-methyl-4-pyridinyl)propyl]phenyl]benzoic acid.
| Compound Name | 2-chloro-4-[4-[(3Z)-3-hydroxyimino-1-(2-methylphenyl)-3-(2-methyl-4-pyridinyl)propyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 159290468 |
| Molecular Formula | C29H25ClN2O3 |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 2-chloro-4-[4-[(3Z)-3-hydroxyimino-1-(2-methylphenyl)-3-(2-methyl-4-pyridinyl)propyl]phenyl]benzoic acid |
| SMILES | Cc1cc(/C(CC(c2ccc(-c3ccc(C(=O)O)c(Cl)c3)cc2)c2ccccc2C)=N\O)ccn1 |
| InChI | InChI=1S/C29H25ClN2O3/c1-18-5-3-4-6-24(18)26(17-28(32-35)23-13-14-31-19(2)15-23)21-9-7-20(8-10-21)22-11-12-25(29(33)34)27(30)16-22/h3-16,26,35H,17H2,1-2H3,(H,33,34)/b32-28- |
| InChIKey | LAAYFLYFJFWCMN-BLCKFSMSSA-N |
| XLogP | 7.12 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|