C26H25N5O3 — CID 173006360
2-[4-[4-[(1R)-3-hydroxyimino-1-(2-methylphenyl)-3-(2-methyl-4-pyridinyl)propyl]phenyl]triazol-1-yl]acetic acid (PubChem CID 173006360) has the molecular formula C26H25N5O3 and a molecular weight of 455.52 g/mol. Its IUPAC name is 2-[4-[4-[(1R)-3-hydroxyimino-1-(2-methylphenyl)-3-(2-methyl-4-pyridinyl)propyl]phenyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[4-[(1R)-3-hydroxyimino-1-(2-methylphenyl)-3-(2-methyl-4-pyridinyl)propyl]phenyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 173006360 |
| Molecular Formula | C26H25N5O3 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 2-[4-[4-[(1R)-3-hydroxyimino-1-(2-methylphenyl)-3-(2-methyl-4-pyridinyl)propyl]phenyl]triazol-1-yl]acetic acid |
| SMILES | Cc1cc(C(C[C@H](c2ccc(-c3cn(CC(=O)O)nn3)cc2)c2ccccc2C)=NO)ccn1 |
| InChI | InChI=1S/C26H25N5O3/c1-17-5-3-4-6-22(17)23(14-24(29-34)21-11-12-27-18(2)13-21)19-7-9-20(10-8-19)25-15-31(30-28-25)16-26(32)33/h3-13,15,23,34H,14,16H2,1-2H3,(H,32,33)/t23-/m1/s1 |
| InChIKey | KDTBPMDNENBWFP-HSZRJFAPSA-N |
| XLogP | 4.44 |
| TPSA | 113.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|