C21H19FN2O — CID 154041459
N-[1-(2-fluoro-6-methyl-4-pyridinyl)-3,3-diphenylpropylidene]hydroxylamine (PubChem CID 154041459) has the molecular formula C21H19FN2O and a molecular weight of 334.39 g/mol. Its IUPAC name is N-[1-(2-fluoro-6-methyl-4-pyridinyl)-3,3-diphenylpropylidene]hydroxylamine.
| Compound Name | N-[1-(2-fluoro-6-methyl-4-pyridinyl)-3,3-diphenylpropylidene]hydroxylamine |
|---|---|
| PubChem CID | 154041459 |
| Molecular Formula | C21H19FN2O |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | N-[1-(2-fluoro-6-methyl-4-pyridinyl)-3,3-diphenylpropylidene]hydroxylamine |
| SMILES | Cc1cc(C(CC(c2ccccc2)c2ccccc2)=NO)cc(F)n1 |
| InChI | InChI=1S/C21H19FN2O/c1-15-12-18(13-21(22)23-15)20(24-25)14-19(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-13,19,25H,14H2,1H3 |
| InChIKey | NXMSNQAAMLPTEZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|