C24H31NO4S — CID 78110498
4-[N-hydroxy-C-[2-(2-methylphenyl)-2-(4-methylsulfonylphenyl)ethyl]carbonimidoyl]-1-methylcyclohexan-1-ol (PubChem CID 78110498) has the molecular formula C24H31NO4S and a molecular weight of 429.58 g/mol. Its IUPAC name is 4-[N-hydroxy-C-[2-(2-methylphenyl)-2-(4-methylsulfonylphenyl)ethyl]carbonimidoyl]-1-methylcyclohexan-1-ol.
| Compound Name | 4-[N-hydroxy-C-[2-(2-methylphenyl)-2-(4-methylsulfonylphenyl)ethyl]carbonimidoyl]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 78110498 |
| Molecular Formula | C24H31NO4S |
| Molecular Weight | 429.58 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 4-[N-hydroxy-C-[2-(2-methylphenyl)-2-(4-methylsulfonylphenyl)ethyl]carbonimidoyl]-1-methylcyclohexan-1-ol |
| SMILES | Cc1ccccc1C(CC(=NO)C1CCC(C)(O)CC1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C24H31NO4S/c1-17-6-4-5-7-21(17)22(18-8-10-20(11-9-18)30(3,28)29)16-23(25-27)19-12-14-24(2,26)15-13-19/h4-11,19,22,26-27H,12-16H2,1-3H3 |
| InChIKey | FYQREEMBRKLYQM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.58 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|