C23H25NO2S — CID 66666797
2-methyl-4-[(3R)-3-(2-methylphenyl)-3-(4-methylsulfonylphenyl)propyl]pyridine (PubChem CID 66666797) has the molecular formula C23H25NO2S and a molecular weight of 379.53 g/mol. Its IUPAC name is 2-methyl-4-[(3R)-3-(2-methylphenyl)-3-(4-methylsulfonylphenyl)propyl]pyridine.
| Compound Name | 2-methyl-4-[(3R)-3-(2-methylphenyl)-3-(4-methylsulfonylphenyl)propyl]pyridine |
|---|---|
| PubChem CID | 66666797 |
| Molecular Formula | C23H25NO2S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-methyl-4-[(3R)-3-(2-methylphenyl)-3-(4-methylsulfonylphenyl)propyl]pyridine |
| SMILES | Cc1cc(CC[C@H](c2ccc(S(C)(=O)=O)cc2)c2ccccc2C)ccn1 |
| InChI | InChI=1S/C23H25NO2S/c1-17-6-4-5-7-22(17)23(13-8-19-14-15-24-18(2)16-19)20-9-11-21(12-10-20)27(3,25)26/h4-7,9-12,14-16,23H,8,13H2,1-3H3/t23-/m1/s1 |
| InChIKey | WHLYSEOQCSOQSB-HSZRJFAPSA-N |
| XLogP | 4.87 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |