C22H23NO — CID 67015665
(1R)-3-(2-methylphenyl)-1-(2-methyl-4-pyridinyl)-3-phenylpropan-1-ol (PubChem CID 67015665) has the molecular formula C22H23NO and a molecular weight of 317.43 g/mol. Its IUPAC name is (1R)-3-(2-methylphenyl)-1-(2-methyl-4-pyridinyl)-3-phenylpropan-1-ol.
| Compound Name | (1R)-3-(2-methylphenyl)-1-(2-methyl-4-pyridinyl)-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 67015665 |
| Molecular Formula | C22H23NO |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | (1R)-3-(2-methylphenyl)-1-(2-methyl-4-pyridinyl)-3-phenylpropan-1-ol |
| SMILES | Cc1cc([C@H](O)CC(c2ccccc2)c2ccccc2C)ccn1 |
| InChI | InChI=1S/C22H23NO/c1-16-8-6-7-11-20(16)21(18-9-4-3-5-10-18)15-22(24)19-12-13-23-17(2)14-19/h3-14,21-22,24H,15H2,1-2H3/t21?,22-/m1/s1 |
| InChIKey | WLMSATSXLQHJFJ-FOIFJWKZSA-N |
| XLogP | 4.95 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |