About bis(2-methyl-4-propan-2-ylpyridine);2-propan-2-ylphenol
bis(2-methyl-4-propan-2-ylpyridine);2-propan-2-ylphenol (PubChem CID 161345551) has the molecular formula C27H38N2O
and a molecular weight of 406.61 g/mol. Its IUPAC name is bis(2-methyl-4-propan-2-ylpyridine);2-propan-2-ylphenol.
Molecular Properties
| Compound Name | bis(2-methyl-4-propan-2-ylpyridine);2-propan-2-ylphenol |
| PubChem CID | 161345551 |
| Molecular Formula | C27H38N2O |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.30 |
| IUPAC Name | bis(2-methyl-4-propan-2-ylpyridine);2-propan-2-ylphenol |
| SMILES | CC(C)c1ccccc1O.Cc1cc(C(C)C)ccn1.Cc1cc(C(C)C)ccn1 |
| InChI | InChI=1S/2C9H13N.C9H12O/c2*1-7(2)9-4-5-10-8(3)6-9;1-7(2)8-5-3-4-6-9(8)10/h2*4-7H,1-3H3;3-7,10H,1-2H3 |
| InChIKey | VNFYVKVALODPSJ-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(2-methyl-4-propan-2-ylpyridine);2-propan-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methyl-4-propan-2-ylpyridine);2-propan-2-ylphenol?
The IUPAC name of bis(2-methyl-4-propan-2-ylpyridine);2-propan-2-ylphenol (CID 161345551) is bis(2-methyl-4-propan-2-ylpyridine);2-propan-2-ylphenol.
What is the SMILES notation for bis(2-methyl-4-propan-2-ylpyridine);2-propan-2-ylphenol?
The canonical SMILES for bis(2-methyl-4-propan-2-ylpyridine);2-propan-2-ylphenol is CC(C)c1ccccc1O.Cc1cc(C(C)C)ccn1.Cc1cc(C(C)C)ccn1.
What is the InChIKey of bis(2-methyl-4-propan-2-ylpyridine);2-propan-2-ylphenol?
The InChIKey is VNFYVKVALODPSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H13N.C9H12O/c2*1-7(2)9-4-5-10-8(3)6-9;1-7(2)8-5-3-4-6-9(8)10/h2*4-7H,1-3H3;3-7,10H,1-2H3.
What are the key properties of bis(2-methyl-4-propan-2-ylpyridine);2-propan-2-ylphenol?
bis(2-methyl-4-propan-2-ylpyridine);2-propan-2-ylphenol has a molecular weight of 406.61 g/mol, XLogP of 7.54, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methyl-4-propan-2-ylpyridine);2-propan-2-ylphenol is sourced from PubChem (CID 161345551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).