C22H21BrN2O — CID 58043626
(NE)-N-[(4R)-4-(4-bromophenyl)-4-(2-methylphenyl)-1-pyridin-2-ylbutan-2-ylidene]hydroxylamine (PubChem CID 58043626) has the molecular formula C22H21BrN2O and a molecular weight of 409.33 g/mol. Its IUPAC name is (NE)-N-[(4R)-4-(4-bromophenyl)-4-(2-methylphenyl)-1-pyridin-2-ylbutan-2-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(4R)-4-(4-bromophenyl)-4-(2-methylphenyl)-1-pyridin-2-ylbutan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 58043626 |
| Molecular Formula | C22H21BrN2O |
| Molecular Weight | 409.33 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | (NE)-N-[(4R)-4-(4-bromophenyl)-4-(2-methylphenyl)-1-pyridin-2-ylbutan-2-ylidene]hydroxylamine |
| SMILES | Cc1ccccc1[C@H](C/C(Cc1ccccn1)=N\O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H21BrN2O/c1-16-6-2-3-8-21(16)22(17-9-11-18(23)12-10-17)15-20(25-26)14-19-7-4-5-13-24-19/h2-13,22,26H,14-15H2,1H3/b25-20-/t22-/m1/s1 |
| InChIKey | QDBVAPGGSOESJI-IVYNLYIOSA-N |
| XLogP | 5.75 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.33 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|