C7H10ClN — CID 123574094
7-chloro-4-methyl-3,4-dihydro-2H-azepine (PubChem CID 123574094) has the molecular formula C7H10ClN and a molecular weight of 143.62 g/mol. Its IUPAC name is 7-chloro-4-methyl-3,4-dihydro-2H-azepine.
| Compound Name | 7-chloro-4-methyl-3,4-dihydro-2H-azepine |
|---|---|
| PubChem CID | 123574094 |
| Molecular Formula | C7H10ClN |
| Molecular Weight | 143.62 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 7-chloro-4-methyl-3,4-dihydro-2H-azepine |
| SMILES | CC1C=CC(Cl)=NCC1 |
| InChI | InChI=1S/C7H10ClN/c1-6-2-3-7(8)9-5-4-6/h2-3,6H,4-5H2,1H3 |
| InChIKey | COBHQKFDBSRYNL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.62 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |