C8H12ClN — CID 143378595
5-chloro-4,7-dimethyl-3,4-dihydro-2H-azepine (PubChem CID 143378595) has the molecular formula C8H12ClN and a molecular weight of 157.64 g/mol. Its IUPAC name is 5-chloro-4,7-dimethyl-3,4-dihydro-2H-azepine.
| Compound Name | 5-chloro-4,7-dimethyl-3,4-dihydro-2H-azepine |
|---|---|
| PubChem CID | 143378595 |
| Molecular Formula | C8H12ClN |
| Molecular Weight | 157.64 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 5-chloro-4,7-dimethyl-3,4-dihydro-2H-azepine |
| SMILES | CC1=NCCC(C)C(Cl)=C1 |
| InChI | InChI=1S/C8H12ClN/c1-6-3-4-10-7(2)5-8(6)9/h5-6H,3-4H2,1-2H3 |
| InChIKey | MSOASAIJZGSDMG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.64 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |