C29H34F5N3O7 — CID 123574842
N-[7,10-dihydroxy-6,12-dimethyl-3-(2-methylpropyl)-2,5-dioxo-8-[(2,3,4,5,6-pentafluorophenyl)methyl]-1-oxa-4,9-diazacyclododec-11-yl]-2-hydroxybenzamide (PubChem CID 123574842) has the molecular formula C29H34F5N3O7 and a molecular weight of 631.60 g/mol. Its IUPAC name is N-[7,10-dihydroxy-6,12-dimethyl-3-(2-methylpropyl)-2,5-dioxo-8-[(2,3,4,5,6-pentafluorophenyl)methyl]-1-oxa-4,9-diazacyclododec-11-yl]-2-hydroxybenzamide.
| Compound Name | N-[7,10-dihydroxy-6,12-dimethyl-3-(2-methylpropyl)-2,5-dioxo-8-[(2,3,4,5,6-pentafluorophenyl)methyl]-1-oxa-4,9-diazacyclododec-11-yl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 123574842 |
| Molecular Formula | C29H34F5N3O7 |
| Molecular Weight | 631.60 g/mol |
| Exact Mass | 631.23 |
| IUPAC Name | N-[7,10-dihydroxy-6,12-dimethyl-3-(2-methylpropyl)-2,5-dioxo-8-[(2,3,4,5,6-pentafluorophenyl)methyl]-1-oxa-4,9-diazacyclododec-11-yl]-2-hydroxybenzamide |
| SMILES | CC(C)CC1NC(=O)C(C)C(O)C(Cc2c(F)c(F)c(F)c(F)c2F)NC(O)C(NC(=O)c2ccccc2O)C(C)OC1=O |
| InChI | InChI=1S/C29H34F5N3O7/c1-11(2)9-17-29(43)44-13(4)24(37-27(41)14-7-5-6-8-18(14)38)28(42)35-16(25(39)12(3)26(40)36-17)10-15-19(30)21(32)23(34)22(33)20(15)31/h5-8,11-13,16-17,24-25,28,35,38-39,42H,9-10H2,1-4H3,(H,36,40)(H,37,41) |
| InChIKey | BSEGLORUNVQKNQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 157.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.60 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|