C48H36Br2N4 — CID 123575143
16-[4-(5-bromohexa-2,4-dien-2-yl)-6-(4-bromophenyl)-1,3,5-triazin-2-yl]-13,13-dimethyl-5,10-diphenyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),15,17-nonaene (PubChem CID 123575143) has the molecular formula C48H36Br2N4 and a molecular weight of 828.65 g/mol. Its IUPAC name is 16-[4-(5-bromohexa-2,4-dien-2-yl)-6-(4-bromophenyl)-1,3,5-triazin-2-yl]-13,13-dimethyl-5,10-diphenyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),15,17-nonaene.
| Compound Name | 16-[4-(5-bromohexa-2,4-dien-2-yl)-6-(4-bromophenyl)-1,3,5-triazin-2-yl]-13,13-dimethyl-5,10-diphenyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),15,17-nonaene |
|---|---|
| PubChem CID | 123575143 |
| Molecular Formula | C48H36Br2N4 |
| Molecular Weight | 828.65 g/mol |
| Exact Mass | 826.13 |
| IUPAC Name | 16-[4-(5-bromohexa-2,4-dien-2-yl)-6-(4-bromophenyl)-1,3,5-triazin-2-yl]-13,13-dimethyl-5,10-diphenyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),15,17-nonaene |
| SMILES | CC(Br)=CC=C(C)c1nc(-c2ccc(Br)cc2)nc(-c2ccc3c(c2)C(C)(C)c2cc(-c4ccccc4)cc4c5cc(-c6ccccc6)ccc5n-3c24)n1 |
| InChI | InChI=1S/C48H36Br2N4/c1-29(15-16-30(2)49)45-51-46(33-17-21-37(50)22-18-33)53-47(52-45)35-20-24-43-40(27-35)48(3,4)41-28-36(32-13-9-6-10-14-32)26-39-38-25-34(31-11-7-5-8-12-31)19-23-42(38)54(43)44(39)41/h5-28H,1-4H3 |
| InChIKey | NHXQRVYOHMBLJB-UHFFFAOYSA-N |
| XLogP | 13.74 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.65 |
| LogP ≤ 5 | 13.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|