C34H21F3N4 — CID 169287117
9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-(trifluoromethyl)phenyl]carbazole (PubChem CID 169287117) has the molecular formula C34H21F3N4 and a molecular weight of 542.56 g/mol. Its IUPAC name is 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-(trifluoromethyl)phenyl]carbazole.
| Compound Name | 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-(trifluoromethyl)phenyl]carbazole |
|---|---|
| PubChem CID | 169287117 |
| Molecular Formula | C34H21F3N4 |
| Molecular Weight | 542.56 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | 9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-(trifluoromethyl)phenyl]carbazole |
| SMILES | FC(F)(F)c1cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)ccc1-n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C34H21F3N4/c35-34(36,37)27-21-24(19-20-30(27)41-28-17-9-7-15-25(28)26-16-8-10-18-29(26)41)33-39-31(22-11-3-1-4-12-22)38-32(40-33)23-13-5-2-6-14-23/h1-21H |
| InChIKey | IQHDTMUBPZWJPZ-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.56 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |