About [6-(2-iminoethyl)-5-methylcyclohexa-1,5-dien-1-yl]methanol
[6-(2-iminoethyl)-5-methylcyclohexa-1,5-dien-1-yl]methanol (PubChem CID 123575259) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is [6-(2-iminoethyl)-5-methylcyclohexa-1,5-dien-1-yl]methanol.
Molecular Properties
| Compound Name | [6-(2-iminoethyl)-5-methylcyclohexa-1,5-dien-1-yl]methanol |
| PubChem CID | 123575259 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | [6-(2-iminoethyl)-5-methylcyclohexa-1,5-dien-1-yl]methanol |
| SMILES | [H]/N=C/CC1=C(C)CCC=C1CO |
| InChI | InChI=1S/C10H15NO/c1-8-3-2-4-9(7-12)10(8)5-6-11/h4,6,11-12H,2-3,5,7H2,1H3/b11-6+ |
| InChIKey | LPMLSOIRQSFKQH-IZZDOVSWSA-N |
| XLogP | 2.06 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [6-(2-iminoethyl)-5-methylcyclohexa-1,5-dien-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(2-iminoethyl)-5-methylcyclohexa-1,5-dien-1-yl]methanol?
The IUPAC name of [6-(2-iminoethyl)-5-methylcyclohexa-1,5-dien-1-yl]methanol (CID 123575259) is [6-(2-iminoethyl)-5-methylcyclohexa-1,5-dien-1-yl]methanol.
What is the SMILES notation for [6-(2-iminoethyl)-5-methylcyclohexa-1,5-dien-1-yl]methanol?
The canonical SMILES for [6-(2-iminoethyl)-5-methylcyclohexa-1,5-dien-1-yl]methanol is [H]/N=C/CC1=C(C)CCC=C1CO.
What is the InChIKey of [6-(2-iminoethyl)-5-methylcyclohexa-1,5-dien-1-yl]methanol?
The InChIKey is LPMLSOIRQSFKQH-IZZDOVSWSA-N. The full InChI is InChI=1S/C10H15NO/c1-8-3-2-4-9(7-12)10(8)5-6-11/h4,6,11-12H,2-3,5,7H2,1H3/b11-6+.
What are the key properties of [6-(2-iminoethyl)-5-methylcyclohexa-1,5-dien-1-yl]methanol?
[6-(2-iminoethyl)-5-methylcyclohexa-1,5-dien-1-yl]methanol has a molecular weight of 165.24 g/mol, XLogP of 2.06, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(2-iminoethyl)-5-methylcyclohexa-1,5-dien-1-yl]methanol is sourced from PubChem (CID 123575259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).