C12H21NO — CID 143193804
ethane;4-methanimidoylcyclohexa-2,4-dien-1-ol;prop-1-ene (PubChem CID 143193804) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is ethane;4-methanimidoylcyclohexa-2,4-dien-1-ol;prop-1-ene.
| Compound Name | ethane;4-methanimidoylcyclohexa-2,4-dien-1-ol;prop-1-ene |
|---|---|
| PubChem CID | 143193804 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | ethane;4-methanimidoylcyclohexa-2,4-dien-1-ol;prop-1-ene |
| SMILES | C=CC.CC.[H]/N=C/C1=CCC(O)C=C1 |
| InChI | InChI=1S/C7H9NO.C3H6.C2H6/c8-5-6-1-3-7(9)4-2-6;1-3-2;1-2/h1-3,5,7-9H,4H2;3H,1H2,2H3;1-2H3/b8-5+;; |
| InChIKey | GBGWDZUXUSCRHW-RMZRELHQSA-N |
| XLogP | 3.10 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|