C9H15NO — CID 142150429
(3Z,5Z)-7-imino-5,6-dimethylhepta-3,5-dien-2-ol (PubChem CID 142150429) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (3Z,5Z)-7-imino-5,6-dimethylhepta-3,5-dien-2-ol.
| Compound Name | (3Z,5Z)-7-imino-5,6-dimethylhepta-3,5-dien-2-ol |
|---|---|
| PubChem CID | 142150429 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (3Z,5Z)-7-imino-5,6-dimethylhepta-3,5-dien-2-ol |
| SMILES | [H]/N=C/C(C)=C(C)\C=C/C(C)O |
| InChI | InChI=1S/C9H15NO/c1-7(8(2)6-10)4-5-9(3)11/h4-6,9-11H,1-3H3/b5-4-,8-7-,10-6+ |
| InChIKey | SWNYYJRNUOZVAT-VGEZGYKQSA-N |
| XLogP | 1.91 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|