C9H13NO — CID 142016028
(3Z)-3-methanimidoyl-5-methylidenehepta-1,3-dien-2-ol (PubChem CID 142016028) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (3Z)-3-methanimidoyl-5-methylidenehepta-1,3-dien-2-ol.
| Compound Name | (3Z)-3-methanimidoyl-5-methylidenehepta-1,3-dien-2-ol |
|---|---|
| PubChem CID | 142016028 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (3Z)-3-methanimidoyl-5-methylidenehepta-1,3-dien-2-ol |
| SMILES | [H]/N=C/C(=C/C(=C)CC)C(=C)O |
| InChI | InChI=1S/C9H13NO/c1-4-7(2)5-9(6-10)8(3)11/h5-6,10-11H,2-4H2,1H3/b9-5-,10-6+ |
| InChIKey | FBIYZVLPZIYAFJ-VTBWALSUSA-N |
| XLogP | 2.60 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|