C10H13NO — CID 142596756
6-methanimidoyl-2-prop-2-enylcyclohexa-1,5-dien-1-ol (PubChem CID 142596756) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 6-methanimidoyl-2-prop-2-enylcyclohexa-1,5-dien-1-ol.
| Compound Name | 6-methanimidoyl-2-prop-2-enylcyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 142596756 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 6-methanimidoyl-2-prop-2-enylcyclohexa-1,5-dien-1-ol |
| SMILES | [H]/N=C/C1=CCCC(CC=C)=C1O |
| InChI | InChI=1S/C10H13NO/c1-2-4-8-5-3-6-9(7-11)10(8)12/h2,6-7,11-12H,1,3-5H2/b11-7+ |
| InChIKey | PKHPOTAUCBSJKL-YRNVUSSQSA-N |
| XLogP | 2.74 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|