C10H17NO — CID 143193809
ethane;(3Z,5E)-5-methanimidoylhepta-1,3,5-trien-2-ol (PubChem CID 143193809) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is ethane;(3Z,5E)-5-methanimidoylhepta-1,3,5-trien-2-ol.
| Compound Name | ethane;(3Z,5E)-5-methanimidoylhepta-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 143193809 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | ethane;(3Z,5E)-5-methanimidoylhepta-1,3,5-trien-2-ol |
| SMILES | CC.[H]/N=C/C(/C=C\C(=C)O)=C/C |
| InChI | InChI=1S/C8H11NO.C2H6/c1-3-8(6-9)5-4-7(2)10;1-2/h3-6,9-10H,2H2,1H3;1-2H3/b5-4-,8-3+,9-6+; |
| InChIKey | JFOQYGGOYUEEPM-ITNGFIIJSA-N |
| XLogP | 3.24 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|