C18H25NO — CID 142350881
(2E,4E,7E,9Z)-7-ethyl-1-imino-2-methyl-6-propan-2-ylidenedodeca-2,4,7,9,11-pentaen-4-ol (PubChem CID 142350881) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is (2E,4E,7E,9Z)-7-ethyl-1-imino-2-methyl-6-propan-2-ylidenedodeca-2,4,7,9,11-pentaen-4-ol.
| Compound Name | (2E,4E,7E,9Z)-7-ethyl-1-imino-2-methyl-6-propan-2-ylidenedodeca-2,4,7,9,11-pentaen-4-ol |
|---|---|
| PubChem CID | 142350881 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | (2E,4E,7E,9Z)-7-ethyl-1-imino-2-methyl-6-propan-2-ylidenedodeca-2,4,7,9,11-pentaen-4-ol |
| SMILES | [H]/N=C/C(C)=C/C(O)=C/C(=C(C)C)/C(=C/C=C\C=C)CC |
| InChI | InChI=1S/C18H25NO/c1-6-8-9-10-16(7-2)18(14(3)4)12-17(20)11-15(5)13-19/h6,8-13,19-20H,1,7H2,2-5H3/b9-8-,15-11+,16-10+,17-12+,19-13+ |
| InChIKey | SHXLVCRGXHGZIV-JXDFLWPMSA-N |
| XLogP | 5.44 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|