C11H14FNO — CID 90929518
7-fluoro-8-imino-6-methyl-2,5-dimethylideneocta-3,6-dien-1-ol (PubChem CID 90929518) has the molecular formula C11H14FNO and a molecular weight of 195.24 g/mol. Its IUPAC name is 7-fluoro-8-imino-6-methyl-2,5-dimethylideneocta-3,6-dien-1-ol.
| Compound Name | 7-fluoro-8-imino-6-methyl-2,5-dimethylideneocta-3,6-dien-1-ol |
|---|---|
| PubChem CID | 90929518 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 7-fluoro-8-imino-6-methyl-2,5-dimethylideneocta-3,6-dien-1-ol |
| SMILES | [H]/N=C/C(F)=C(C)C(=C)C=CC(=C)CO |
| InChI | InChI=1S/C11H14FNO/c1-8(7-14)4-5-9(2)10(3)11(12)6-13/h4-6,13-14H,1-2,7H2,3H3/b5-4?,11-10?,13-6+ |
| InChIKey | HXBVVSMVSAQPLF-CECLBAFHSA-N |
| XLogP | 2.54 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|