C8H11NO — CID 143723976
(2Z,4E)-4-methanimidoylhepta-2,4,6-trien-1-ol (PubChem CID 143723976) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is (2Z,4E)-4-methanimidoylhepta-2,4,6-trien-1-ol.
| Compound Name | (2Z,4E)-4-methanimidoylhepta-2,4,6-trien-1-ol |
|---|---|
| PubChem CID | 143723976 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (2Z,4E)-4-methanimidoylhepta-2,4,6-trien-1-ol |
| SMILES | [H]/N=C/C(/C=C\CO)=C/C=C |
| InChI | InChI=1S/C8H11NO/c1-2-4-8(7-9)5-3-6-10/h2-5,7,9-10H,1,6H2/b5-3-,8-4+,9-7+ |
| InChIKey | PDSMIBYCHHOTLO-NRBQJMABSA-N |
| XLogP | 1.30 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|