C56H41FN4O — CID 123575500
1-[5-[6-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]dibenzofuran-4-yl]cyclohexa-1,5-dien-1-yl]-N-[fluoro(phenyl)methyl]-3-phenylpropane-1,3-diimine (PubChem CID 123575500) has the molecular formula C56H41FN4O and a molecular weight of 804.97 g/mol. Its IUPAC name is 1-[5-[6-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]dibenzofuran-4-yl]cyclohexa-1,5-dien-1-yl]-N-[fluoro(phenyl)methyl]-3-phenylpropane-1,3-diimine.
| Compound Name | 1-[5-[6-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]dibenzofuran-4-yl]cyclohexa-1,5-dien-1-yl]-N-[fluoro(phenyl)methyl]-3-phenylpropane-1,3-diimine |
|---|---|
| PubChem CID | 123575500 |
| Molecular Formula | C56H41FN4O |
| Molecular Weight | 804.97 g/mol |
| Exact Mass | 804.33 |
| IUPAC Name | 1-[5-[6-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]dibenzofuran-4-yl]cyclohexa-1,5-dien-1-yl]-N-[fluoro(phenyl)methyl]-3-phenylpropane-1,3-diimine |
| SMILES | [H]/N=C(\CC(=NC(F)c1ccccc1)C1=CCCC(c2cccc3c2oc2c(-c4cccc(-c5cc(-c6ccccc6)nc(-c6ccccc6)n5)c4)cccc23)=C1)c1ccccc1 |
| InChI | InChI=1S/C56H41FN4O/c57-55(39-21-9-3-10-22-39)59-50(35-49(58)37-17-5-1-6-18-37)43-27-13-25-41(33-43)45-29-15-31-47-48-32-16-30-46(54(48)62-53(45)47)42-26-14-28-44(34-42)52-36-51(38-19-7-2-8-20-38)60-56(61-52)40-23-11-4-12-24-40/h1-12,14-24,26-34,36,55,58H,13,25,35H2/b58-49+,59-50? |
| InChIKey | HHRVRICCNFECFV-PBOYVWFGSA-N |
| XLogP | 14.72 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.97 |
| LogP ≤ 5 | 14.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|