C26H25N5O3 — CID 123575590
3-[3-[[4-(4-methylpiperazin-1-yl)benzoyl]amino]-1H-indazol-6-yl]benzoic acid (PubChem CID 123575590) has the molecular formula C26H25N5O3 and a molecular weight of 455.52 g/mol. Its IUPAC name is 3-[3-[[4-(4-methylpiperazin-1-yl)benzoyl]amino]-1H-indazol-6-yl]benzoic acid.
| Compound Name | 3-[3-[[4-(4-methylpiperazin-1-yl)benzoyl]amino]-1H-indazol-6-yl]benzoic acid |
|---|---|
| PubChem CID | 123575590 |
| Molecular Formula | C26H25N5O3 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 3-[3-[[4-(4-methylpiperazin-1-yl)benzoyl]amino]-1H-indazol-6-yl]benzoic acid |
| SMILES | CN1CCN(c2ccc(C(=O)Nc3n[nH]c4cc(-c5cccc(C(=O)O)c5)ccc34)cc2)CC1 |
| InChI | InChI=1S/C26H25N5O3/c1-30-11-13-31(14-12-30)21-8-5-17(6-9-21)25(32)27-24-22-10-7-19(16-23(22)28-29-24)18-3-2-4-20(15-18)26(33)34/h2-10,15-16H,11-14H2,1H3,(H,33,34)(H2,27,28,29,32) |
| InChIKey | WPJWLDATPTWZJJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |