C23H30F3N5O2Si — CID 123575843
trimethyl-[2-[[3-[6-[6-(2-methylpropoxy)-3-pyridinyl]-3-pyridinyl]-5-(trifluoromethyl)-1,2,4-triazol-1-yl]methoxy]ethyl]silane (PubChem CID 123575843) has the molecular formula C23H30F3N5O2Si and a molecular weight of 493.61 g/mol. Its IUPAC name is trimethyl-[2-[[3-[6-[6-(2-methylpropoxy)-3-pyridinyl]-3-pyridinyl]-5-(trifluoromethyl)-1,2,4-triazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[3-[6-[6-(2-methylpropoxy)-3-pyridinyl]-3-pyridinyl]-5-(trifluoromethyl)-1,2,4-triazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 123575843 |
| Molecular Formula | C23H30F3N5O2Si |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | trimethyl-[2-[[3-[6-[6-(2-methylpropoxy)-3-pyridinyl]-3-pyridinyl]-5-(trifluoromethyl)-1,2,4-triazol-1-yl]methoxy]ethyl]silane |
| SMILES | CC(C)COc1ccc(-c2ccc(-c3nc(C(F)(F)F)n(COCC[Si](C)(C)C)n3)cn2)cn1 |
| InChI | InChI=1S/C23H30F3N5O2Si/c1-16(2)14-33-20-9-7-17(12-28-20)19-8-6-18(13-27-19)21-29-22(23(24,25)26)31(30-21)15-32-10-11-34(3,4)5/h6-9,12-13,16H,10-11,14-15H2,1-5H3 |
| InChIKey | HYPGAIMWUIHIPR-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|