C20H19BClFN2O4 — CID 123575951
3-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8-fluoro-1H-quinazoline-2,4-dione (PubChem CID 123575951) has the molecular formula C20H19BClFN2O4 and a molecular weight of 416.65 g/mol. Its IUPAC name is 3-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8-fluoro-1H-quinazoline-2,4-dione.
| Compound Name | 3-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8-fluoro-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 123575951 |
| Molecular Formula | C20H19BClFN2O4 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 3-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-8-fluoro-1H-quinazoline-2,4-dione |
| SMILES | CC1(C)OB(c2cccc(-n3c(=O)[nH]c4c(F)cccc4c3=O)c2Cl)OC1(C)C |
| InChI | InChI=1S/C20H19BClFN2O4/c1-19(2)20(3,4)29-21(28-19)12-8-6-10-14(15(12)22)25-17(26)11-7-5-9-13(23)16(11)24-18(25)27/h5-10H,1-4H3,(H,24,27) |
| InChIKey | MHSQCBJJEQWMLA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|