C30H25ClFN3O6S — CID 123576931
2-[[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-[1]benzothiolo[2,3-d]pyrimidin-7-yl]peroxycarbonyl]-2-ethylbutanoic acid (PubChem CID 123576931) has the molecular formula C30H25ClFN3O6S and a molecular weight of 610.06 g/mol. Its IUPAC name is 2-[[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-[1]benzothiolo[2,3-d]pyrimidin-7-yl]peroxycarbonyl]-2-ethylbutanoic acid.
| Compound Name | 2-[[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-[1]benzothiolo[2,3-d]pyrimidin-7-yl]peroxycarbonyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 123576931 |
| Molecular Formula | C30H25ClFN3O6S |
| Molecular Weight | 610.06 g/mol |
| Exact Mass | 609.11 |
| IUPAC Name | 2-[[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-[1]benzothiolo[2,3-d]pyrimidin-7-yl]peroxycarbonyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(C(=O)O)C(=O)OOc1ccc2c(c1)sc1ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c12 |
| InChI | InChI=1S/C30H25ClFN3O6S/c1-3-30(4-2,28(36)37)29(38)41-40-20-9-10-21-24(14-20)42-27-25(21)26(33-16-34-27)35-19-8-11-23(22(31)13-19)39-15-17-6-5-7-18(32)12-17/h5-14,16H,3-4,15H2,1-2H3,(H,36,37)(H,33,34,35) |
| InChIKey | IWJKZFRYZAMEJY-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 119.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.06 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|